cas: 1346707-95-6 — see every product listed under this CAS number, including other names
2-Cyclopropoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97% (CAS 1346707-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HTQ0-100mg |
| cas | 1346707-95-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 5g | 2718.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-cyclopropyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1346707-95-6) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 2-cyclopropyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QGITZZUHNXEWIV-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 2-cyclopropyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QGITZZUHNXEWIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OC3CC3 |
Computed by PubChem (NCBI)