cas: 2098215-65-5 — see every product listed under this CAS number, including other names
2-Cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2098215-65-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696443-250MG |
| cas | 2098215-65-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2580.36 Pln | |
| Fluorochem | 5g | 10624.40 Pln |
| delivery time | 3-4 weeks |
|---|
2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2098215-65-5) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: BTUATTSYEKDRSV-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | BTUATTSYEKDRSV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)C3CC3 |
Computed by PubChem (NCBI)