cas: 2098215-65-5 — see every product listed under this CAS number, including other names
2-Cyclopropylpyridine-3-boronic Acid Pinacol Ester, >95%, >95% (CAS 2098215-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IM09-100mg |
| cas | 2098215-65-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1350.80 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 5g | 6429.20 Pln | |
| Chemat | 10g | 12467.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2098215-65-5) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: BTUATTSYEKDRSV-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 2-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | BTUATTSYEKDRSV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)C3CC3 |
Computed by PubChem (NCBI)