Products 119897-50-6
CAS 119897-50-6 is the registry number for 2-Deoxy-D-glucose-13C-1. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 10 mg, 1 mg, 25 mg.
(3R,4S,5R)-3,4,5,6-tetrahydroxy(613C)hexanal (CAS 119897-50-6) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 165.15 g/mol. IUPAC name: (3R,4S,5R)-3,4,5,6-tetrahydroxy(613C)hexanal. InChIKey: VRYALKFFQXWPIH-VOXXIEBZSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | (3R,4S,5R)-3,4,5,6-tetrahydroxy(613C)hexanal |
| InChIKey | VRYALKFFQXWPIH-VOXXIEBZSA-N |
| SMILES | C(C=O)[C@H]([C@@H]([C@@H]([13CH2]O)O)O)O |
Computed by PubChem (NCBI)