CAS 154-17-6 appears in our catalog under these names: 2-Deoxy-D-glucose, >95% (HPLC), 2-Deoxy-D-glucose/ 99.77% (existing batch purity), 2–Deoxy–D–glucose, 2-Deoxy-D-glucose, 98% , 2-Deoxy-D-glucose. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 1g, 5g, 500mg, 10mM (in 1ml dmso), 25g, 100g, 50g.
(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal (CAS 154-17-6) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal. InChIKey: VRYALKFFQXWPIH-PBXRRBTRSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | VRYALKFFQXWPIH-PBXRRBTRSA-N |
| SMILES | C(C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)