Products 201740-77-4

CAS 201740-77-4 is the registry number for 2-Deoxy-D-glucose-13C6. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

(3R,4S,5R)-3,4,5,6-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal (CAS 201740-77-4) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 170.11 g/mol. IUPAC name: (3R,4S,5R)-3,4,5,6-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal. InChIKey: VRYALKFFQXWPIH-FBXUKYFESA-N.

Identity
Molecular formulaC6H12O5
Molecular weight170.11 g/mol
IUPAC name(3R,4S,5R)-3,4,5,6-tetrahydroxy(1,2,3,4,5,6-13C6)hexanal
InChIKeyVRYALKFFQXWPIH-FBXUKYFESA-N
SMILES[13CH2]([13CH]=O)[13C@H]([13C@@H]([13C@@H]([13CH2]O)O)O)O

Computed by PubChem (NCBI)

Synonyms: orb3139038