cas: 741709-60-4 — see every product listed under this CAS number, including other names
2-ETHYLPYRIDINE-4-BORONIC ACID PINACOL ESTER, 97%, 97% (CAS 741709-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FH6I-100mg |
| cas | 741709-60-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 500mg | 1442.00 Pln | |
| Chemat | 1g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 741709-60-4) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YYJPHWDHDLLAJH-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YYJPHWDHDLLAJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)CC |
Computed by PubChem (NCBI)