cas: 55150-29-3 — see every product listed under this CAS number, including other names
2-Ethoxy-1-naphthoyl Chloride, ≥97%, ≥97% (CAS 55150-29-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H7I-1g |
| cas | 55150-29-3 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Chemat | 25g | 2810.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-ethoxynaphthalene-1-carbonyl chloride (CAS 55150-29-3) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 2-ethoxynaphthalene-1-carbonyl chloride. InChIKey: ZRVFFIXOCFUHDA-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-ethoxynaphthalene-1-carbonyl chloride |
| InChIKey | ZRVFFIXOCFUHDA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C=C1)C(=O)Cl |
Computed by PubChem (NCBI)