cas: 55150-29-3 — see every product listed under this CAS number, including other names
2-Ethoxy-1-naphthoyl chloride (CAS 55150-29-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F726676-5G |
| cas | 55150-29-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1382.86 Pln | |
| Fluorochem | 25g | 4626.51 Pln |
| delivery time | 3-4 weeks |
|---|
2-ethoxynaphthalene-1-carbonyl chloride (CAS 55150-29-3) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 2-ethoxynaphthalene-1-carbonyl chloride. InChIKey: ZRVFFIXOCFUHDA-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-ethoxynaphthalene-1-carbonyl chloride |
| InChIKey | ZRVFFIXOCFUHDA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C=C1)C(=O)Cl |
Computed by PubChem (NCBI)