cas: 31469-17-7 — see every product listed under this CAS number, including other names
2-Ethyl-1-ethoxy-1-trimethylsiloxy-1-butene, 95-<97% (CAS 31469-17-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6399-95-97-10g |
| cas | 31469-17-7 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 9833.34 Pln | |
| Hoffman Fine Chemicals | 25g | 19358.68 Pln | |
| Hoffman Fine Chemicals | 50g | 30791.64 Pln | |
| Hoffman Fine Chemicals | 100g | 49076.72 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
(1-ethoxy-2-ethylbut-1-enoxy)-trimethylsilane (CAS 31469-17-7) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: (1-ethoxy-2-ethylbut-1-enoxy)-trimethylsilane. InChIKey: SBVWAAREENULAS-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | (1-ethoxy-2-ethylbut-1-enoxy)-trimethylsilane |
| InChIKey | SBVWAAREENULAS-UHFFFAOYSA-N |
| SMILES | CCC(=C(OCC)O[Si](C)(C)C)CC |
Computed by PubChem (NCBI)