cas: 80866-90-6 — see every product listed under this CAS number, including other names
2-Ethyl-2-phenylmalonamide monohydrate, 95%, 95% (CAS 80866-90-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H7Y-250mg |
| cas | 80866-90-6 |
| size | 250mg |
| availability | 1.999g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-ethyl-2-phenylpropanediamide;hydrate (CAS 80866-90-6) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 2-ethyl-2-phenylpropanediamide;hydrate. InChIKey: FZSBWHZDTUPYRX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-ethyl-2-phenylpropanediamide;hydrate |
| InChIKey | FZSBWHZDTUPYRX-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)(C(=O)N)C(=O)N.O |
Computed by PubChem (NCBI)