CAS 80866-90-6 appears in our catalog under these names: 2-Ethyl-2-phenylmalonamide hydrate, 95%, 2-Ethyl-2-phenylpropane-diamide Hydrate (Ethylphenylmalonamide Hydrate), 2-ETHYL-2-PHENYLMALONAMIDE MONOHYDRATE,&, 2-Ethyl-2-phenylmalonamide monohydrate, 95%, 95%. Offered by: Combi-blocks, Mikromol, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25mg, 100mg, 250mg.
2-ethyl-2-phenylpropanediamide;hydrate (CAS 80866-90-6) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 2-ethyl-2-phenylpropanediamide;hydrate. InChIKey: FZSBWHZDTUPYRX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-ethyl-2-phenylpropanediamide;hydrate |
| InChIKey | FZSBWHZDTUPYRX-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)(C(=O)N)C(=O)N.O |
Computed by PubChem (NCBI)