cas: 874459-62-8 — see every product listed under this CAS number, including other names
2-FLUORO-4-ETHOXYCARBONYLPHENYLBORONIC ACID, 97%, 97% (CAS 874459-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115FUO-250mg |
| cas | 874459-62-8 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 525.20 Pln | |
| Chemat | 25g | 2416.40 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-ethoxycarbonyl-2-fluorophenyl)boronic acid (CAS 874459-62-8) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: (4-ethoxycarbonyl-2-fluorophenyl)boronic acid. InChIKey: HBXIRLABZXFDAX-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | (4-ethoxycarbonyl-2-fluorophenyl)boronic acid |
| InChIKey | HBXIRLABZXFDAX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OCC)F)(O)O |
Computed by PubChem (NCBI)