cas: 142314-70-3 — see every product listed under this CAS number, including other names
2-FORMYL-6-NITROBENZOIC ACID METHYL ESTER, 97% (CAS 142314-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F542350-100MG |
| cas | 142314-70-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1815.00 Pln | |
| Fluorochem | 10g | 3043.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-formyl-6-nitrobenzoate (CAS 142314-70-3) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: methyl 2-formyl-6-nitrobenzoate. InChIKey: UFSGWOAUSVQOQB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | methyl 2-formyl-6-nitrobenzoate |
| InChIKey | UFSGWOAUSVQOQB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)