Products 2384395-80-4
CAS 2384395-80-4 is the registry number for 2-(Methoxycarbonyl)-4H-furo[3,2-b]pyrrole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxycarbonyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 2384395-80-4) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: 2-methoxycarbonyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: DXWZDLHIMHGZFR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 2-methoxycarbonyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | DXWZDLHIMHGZFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)