Products 38712-57-1

CAS 38712-57-1 is the registry number for 3-(3-Nitrophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-nitrophenyl)-2-oxopropanoic acid (CAS 38712-57-1) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: 3-(3-nitrophenyl)-2-oxopropanoic acid. InChIKey: JTJJIPVJAFWSBS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO5
Molecular weight209.16 g/mol
IUPAC name3-(3-nitrophenyl)-2-oxopropanoic acid
InChIKeyJTJJIPVJAFWSBS-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])CC(=O)C(=O)O

Computed by PubChem (NCBI)