Products 5461-32-5
CAS 5461-32-5 appears in our catalog under these names: 2-Nitrophenylpyruvic acid, 98%, 2–Nitrophenylpyruvic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 10g.
3-(2-nitrophenyl)-2-oxopropanoic acid (CAS 5461-32-5) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: 3-(2-nitrophenyl)-2-oxopropanoic acid. InChIKey: CGCWRLDEYHZQCW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 3-(2-nitrophenyl)-2-oxopropanoic acid |
| InChIKey | CGCWRLDEYHZQCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Nitrophenylpyruvic acid, 3-(2-nitrophenyl)-2-oxopropanoic acid, Pyruvic acid, (o-nitrophenyl)-, o-NITROPHENYLPYRUVIC ACID, Ortho-nitrophenylpyruvic acid, Benzenepropanoic acid, 2-nitro-alpha-oxo-, (2-Nitrophenyl)pyruvic acid, 2-nitro-alpha-oxobenzenepropanoic acid, 3-(2-nitrophenyl)pyruvic acid, Benzenepropanoic acid, 2-nitro-.alpha.-oxo-