cas: 321-60-8 — see every product listed under this CAS number, including other names
2-Fluoro-1,1'-biphenyl, 98%, 98% (CAS 321-60-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HBQ-10g |
| cas | 321-60-8 |
| size | 10g |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-fluoro-2-phenylbenzene (CAS 321-60-8) is a chemical compound with the molecular formula C12H9F and a molecular weight of 172.20 g/mol. IUPAC name: 1-fluoro-2-phenylbenzene. InChIKey: KLECYOQFQXJYBC-UHFFFAOYSA-N.
| Molecular formula | C12H9F |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | 1-fluoro-2-phenylbenzene |
| InChIKey | KLECYOQFQXJYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2F |
Computed by PubChem (NCBI)