CAS 321-60-8 appears in our catalog under these names: 2-Fluorobiphenyl, 98%, Flurbiprofen Impurity 45, 2-Fluorobiphenyl, 2-Fluorobiphenyl, >95% (HPLC), 2-Fluorobiphenyl 2000 µg/mL in Cyclohexane. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 100g, 25g, 5g, 500g, on request, 100mg, 1ml, 1g.
1-fluoro-2-phenylbenzene (CAS 321-60-8) is a chemical compound with the molecular formula C12H9F and a molecular weight of 172.20 g/mol. IUPAC name: 1-fluoro-2-phenylbenzene. InChIKey: KLECYOQFQXJYBC-UHFFFAOYSA-N.
| Molecular formula | C12H9F |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | 1-fluoro-2-phenylbenzene |
| InChIKey | KLECYOQFQXJYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2F |
Computed by PubChem (NCBI)