cas: 321-60-8 — see every product listed under this CAS number, including other names
2-Fluorobiphenyl, >97.0%(GC) (CAS 321-60-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0265-5G |
| cas | 321-60-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 374.04 Pln | |
| TCI | 25g | 787.09 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1-fluoro-2-phenylbenzene (CAS 321-60-8) is a chemical compound with the molecular formula C12H9F and a molecular weight of 172.20 g/mol. IUPAC name: 1-fluoro-2-phenylbenzene. InChIKey: KLECYOQFQXJYBC-UHFFFAOYSA-N.
| Molecular formula | C12H9F |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | 1-fluoro-2-phenylbenzene |
| InChIKey | KLECYOQFQXJYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2F |
Computed by PubChem (NCBI)