2-Fluoro-3-methyl-6-nitroaniline, 98%, 98%
cas: 1261676-68-9 — see every product listed under this CAS number, including other names
2-Fluoro-3-methyl-6-nitroaniline, 98%, 98% (CAS 1261676-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RYF-250mg |
| cas | 1261676-68-9 |
| size | 250mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 1696.40 Pln | |
| Chemat | 10g | 2795.60 Pln | |
| Chemat | 25g | 5526.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-3-methyl-6-nitroaniline (CAS 1261676-68-9) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 2-fluoro-3-methyl-6-nitroaniline. InChIKey: ZSDGOICOFHCJJL-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-fluoro-3-methyl-6-nitroaniline |
| InChIKey | ZSDGOICOFHCJJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])N)F |
Computed by PubChem (NCBI)