Products 681034-74-2
CAS 681034-74-2 appears in our catalog under these names: 5-Cyclopropyl-4-fluoro-1h-pyrazole-3-carboxylic acid, 95%, 5–Cyclopropyl–4–fluoro–1H–pyrazole–3–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 10mg.
5-cyclopropyl-4-fluoro-1H-pyrazole-3-carboxylic acid (CAS 681034-74-2) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 5-cyclopropyl-4-fluoro-1H-pyrazole-3-carboxylic acid. InChIKey: HUZXKCFWZDRLJR-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 5-cyclopropyl-4-fluoro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HUZXKCFWZDRLJR-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NN2)C(=O)O)F |
Computed by PubChem (NCBI)