CAS 449774-77-0 appears in our catalog under these names: 2-Fluoro-4-methyl-6-nitroaniline, 96%, 2-Fluoro-4-methyl-6-nitroaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-fluoro-4-methyl-6-nitroaniline (CAS 449774-77-0) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 2-fluoro-4-methyl-6-nitroaniline. InChIKey: PWOCRYSEVNPPKC-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-fluoro-4-methyl-6-nitroaniline |
| InChIKey | PWOCRYSEVNPPKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)