CAS 1000342-98-2 appears in our catalog under these names: 3-Fluoro-2-methyl-4-nitroaniline, 95%, 3–Fluoro–2–methyl–4–nitro–phenylamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
3-fluoro-2-methyl-4-nitroaniline (CAS 1000342-98-2) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 3-fluoro-2-methyl-4-nitroaniline. InChIKey: NFWVJCKMVIGVLF-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 3-fluoro-2-methyl-4-nitroaniline |
| InChIKey | NFWVJCKMVIGVLF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)