cas: 21397-11-5 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitroaniline, 95% (CAS 21397-11-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233812-100MG |
| cas | 21397-11-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 1518.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-fluoro-3-nitroaniline (CAS 21397-11-5) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-3-nitroaniline. InChIKey: NGFSHIJLJGVNTO-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-3-nitroaniline |
| InChIKey | NGFSHIJLJGVNTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)