CAS 2369-12-2 appears in our catalog under these names: 5-Fluoro-3-nitroaniline, 98%, 3-Fluoro-5-nitroaniline 98%, Benzenamine, 3-fluoro-5-nitro-, 98%, 98%, 3-Fluoro-5-nitroaniline, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
3-fluoro-5-nitroaniline (CAS 2369-12-2) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-5-nitroaniline. InChIKey: OPMFAZASMJCCOQ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-5-nitroaniline |
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)