CAS 19346-46-4 appears in our catalog under these names: 2-Fluoro-5-nitro-3-picoline, 98%, 2-Fluoro-3-methyl-5-nitropyridine 97% (contains 2-5%dioxane), 2-Fluoro-5-nitro-3-methylpyridine. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
2-fluoro-3-methyl-5-nitropyridine (CAS 19346-46-4) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-3-methyl-5-nitropyridine. InChIKey: CFKHKTLGKNBEPI-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-3-methyl-5-nitropyridine |
| InChIKey | CFKHKTLGKNBEPI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)