Products 21397-11-5
CAS 21397-11-5 appears in our catalog under these names: 2-Fluoro-3-nitroaniline, 98%, 2–Fluoro–3–nitrobenzenamine, 2-Fluoro-3-nitroaniline 98%, 2-Fluoro-3-nitrobenzenamine, 98%, 98%, 2-Fluoro-3-nitroaniline, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
2-fluoro-3-nitroaniline (CAS 21397-11-5) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-3-nitroaniline. InChIKey: NGFSHIJLJGVNTO-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-3-nitroaniline |
| InChIKey | NGFSHIJLJGVNTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)