2-Fluoro-3-nitrobenzonitrile, 95%
cas: 1214328-20-7 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitrobenzonitrile, 95% (CAS 1214328-20-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1125RK-250mg |
| cas | 1214328-20-7 |
| size | 250mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 261.20 Pln | |
| Chemat | 25g | 563.60 Pln | |
| Chemat | 100g | 1912.40 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 789.32 Pln | |
| Fluorochem | 50g | 1226.67 Pln | |
| Fluorochem | 100g | 2361.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-3-nitrobenzonitrile (CAS 1214328-20-7) is a chemical compound with the molecular formula C7H3FN2O2 and a molecular weight of 166.11 g/mol. IUPAC name: 2-fluoro-3-nitrobenzonitrile. InChIKey: LHCVWZUYSBZIKE-UHFFFAOYSA-N.
| Molecular formula | C7H3FN2O2 |
|---|---|
| Molecular weight | 166.11 g/mol |
| IUPAC name | 2-fluoro-3-nitrobenzonitrile |
| InChIKey | LHCVWZUYSBZIKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)C#N |
Computed by PubChem (NCBI)