Products 1334722-34-7
CAS 1334722-34-7 is the registry number for 5-Cyano-2-fluoronicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyano-2-fluoropyridine-3-carboxylic acid (CAS 1334722-34-7) is a chemical compound with the molecular formula C7H3FN2O2 and a molecular weight of 166.11 g/mol. IUPAC name: 5-cyano-2-fluoropyridine-3-carboxylic acid. InChIKey: GTMGJUBJMPZIKN-UHFFFAOYSA-N.
| Molecular formula | C7H3FN2O2 |
|---|---|
| Molecular weight | 166.11 g/mol |
| IUPAC name | 5-cyano-2-fluoropyridine-3-carboxylic acid |
| InChIKey | GTMGJUBJMPZIKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)F)C#N |
Computed by PubChem (NCBI)