Products 1805459-35-1

CAS 1805459-35-1 is the registry number for 5-Cyano-4-fluoropicolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-cyano-4-fluoropyridine-2-carboxylic acid (CAS 1805459-35-1) is a chemical compound with the molecular formula C7H3FN2O2 and a molecular weight of 166.11 g/mol. IUPAC name: 5-cyano-4-fluoropyridine-2-carboxylic acid. InChIKey: WZLPWVJRGNMNOG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3FN2O2
Molecular weight166.11 g/mol
IUPAC name5-cyano-4-fluoropyridine-2-carboxylic acid
InChIKeyWZLPWVJRGNMNOG-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1C(=O)O)C#N)F

Computed by PubChem (NCBI)