CAS 143306-27-8 appears in our catalog under these names: 2–Fluoro–6–Nitrobenzonitrile, 2-Fluoro-6-nitrobenzonitrile 95%, 2-Fluoro-6-nitrobenzonitrile, 95%, 95%, 2-Fluoro-6-nitrobenzonitrile, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
2-fluoro-6-nitrobenzonitrile (CAS 143306-27-8) is a chemical compound with the molecular formula C7H3FN2O2 and a molecular weight of 166.11 g/mol. IUPAC name: 2-fluoro-6-nitrobenzonitrile. InChIKey: DOHMTOMVCPKOEE-UHFFFAOYSA-N.
| Molecular formula | C7H3FN2O2 |
|---|---|
| Molecular weight | 166.11 g/mol |
| IUPAC name | 2-fluoro-6-nitrobenzonitrile |
| InChIKey | DOHMTOMVCPKOEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)