2-Fluoro-3-nitrotoluene, 98%, 98%
cas: 437-86-5 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitrotoluene, 98%, 98% (CAS 437-86-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H9Z-5g |
| cas | 437-86-5 |
| size | 5g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 50g | 141.20 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 250g | 419.60 Pln | |
| Chemat | 500g | 787.20 Pln | |
| Chemat | 1kg | 1422.80 Pln | |
| Chemat | 5kg | 7070.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-1-methyl-3-nitrobenzene (CAS 437-86-5) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 2-fluoro-1-methyl-3-nitrobenzene. InChIKey: NBCNUIXYBLFJMI-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2 |
|---|---|
| Molecular weight | 155.13 g/mol |
| IUPAC name | 2-fluoro-1-methyl-3-nitrobenzene |
| InChIKey | NBCNUIXYBLFJMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)