cas: 948018-61-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-(4-methyl-1-piperazinyl)benzoic Acid, >97%, >97% (CAS 948018-61-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H03-250mg |
| cas | 948018-61-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 10g | 3693.20 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 948018-61-9) is a chemical compound with the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. IUPAC name: 2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: OVEGQNMSWXCGBQ-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O2 |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | OVEGQNMSWXCGBQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)