Products 948018-61-9
CAS 948018-61-9 appears in our catalog under these names: 2-Fluoro-4-(4-methyl-1-piperazinyl)benzoic acid, 97%, 2-Fluoro-4-(4-methyl-1-piperazinyl)benzoic Acid, 95-<97%, 2-Fluoro-4-(4-methyl-1-piperazinyl)benzoic Acid, ≥97-<99%, 2-Fluoro-4-(4-methylpiperazin-1-yl)benzoic acid, 98+%, 2–Fluoro–4–(4–methyl–1–piperazinyl)benzoic Acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 50g, 100g, 200g.
2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 948018-61-9) is a chemical compound with the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. IUPAC name: 2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: OVEGQNMSWXCGBQ-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O2 |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 2-fluoro-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | OVEGQNMSWXCGBQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)