Products 1503626-80-9

CAS 1503626-80-9 is the registry number for 4-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid (CAS 1503626-80-9) is a chemical compound with the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. IUPAC name: 4-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: XGFIYVLTBKLHNP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FN2O2
Molecular weight238.26 g/mol
IUPAC name4-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid
InChIKeyXGFIYVLTBKLHNP-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C2=C(C=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)