CAS 1096829-46-7 appears in our catalog under these names: 5-Fluoro-2-(4-methyl-1-piperazinyl)benzoic acid, 95%, 5–Fluoro–2–(4–methyl–1–piperazinyl)benzoic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
5-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid (CAS 1096829-46-7) is a chemical compound with the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. IUPAC name: 5-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: KBFDOPUFARGNDL-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O2 |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 5-fluoro-2-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | KBFDOPUFARGNDL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)