cas: 874289-29-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-(N-ethylaminocarbonyl)phenylboronic acid (CAS 874289-29-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628023-1G |
| cas | 874289-29-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2283.59 Pln | |
| Fluorochem | 5g | 6714.32 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-29-9) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: RVPOYQNEOOWSAW-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [4-(ethylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | RVPOYQNEOOWSAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NCC)F)(O)O |
Computed by PubChem (NCBI)