CAS 957060-85-4 appears in our catalog under these names: (2-Fluoro-4-methylsulfonylphenyl)boronic acid, 2-Fluoro-4-(methylsulfonyl)phenylboronic acid, 98%, 2-Fluoro-4-(methylsulfonyl)phenylboronic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 1g, 5g, 10g.
(2-fluoro-4-methylsulfonylphenyl)boronic acid (CAS 957060-85-4) is a chemical compound with the molecular formula C7H8BFO4S and a molecular weight of 218.02 g/mol. IUPAC name: (2-fluoro-4-methylsulfonylphenyl)boronic acid. InChIKey: VTSHDQJNJIIHGS-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO4S |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (2-fluoro-4-methylsulfonylphenyl)boronic acid |
| InChIKey | VTSHDQJNJIIHGS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)C)F)(O)O |
Computed by PubChem (NCBI)