CAS 1268496-35-0 appears in our catalog under these names: 4-Fluoro-3-(methanesulfonyl)phenylboronic acid, 95%, (4-Fluoro-3-(methylsulfonyl)phenyl)boronic acid, 98%, 4-Fluoro-3-(methanesulfonyl)phenylboronic acid, 4-Fluoro-3-(methanesulfonyl)phenylboronic acid, ≥95%, ≥95%, 4-Fluoro-3-(methanesulfonyl)phenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 2,5g.
(4-fluoro-3-methylsulfonylphenyl)boronic acid (CAS 1268496-35-0) is a chemical compound with the molecular formula C7H8BFO4S and a molecular weight of 218.02 g/mol. IUPAC name: (4-fluoro-3-methylsulfonylphenyl)boronic acid. InChIKey: HLZHIAFQLYBKOG-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO4S |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (4-fluoro-3-methylsulfonylphenyl)boronic acid |
| InChIKey | HLZHIAFQLYBKOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)