CAS 1402238-31-6 is the registry number for 4-Fluoro-2-(methylsulfonyl)phenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(4-fluoro-2-methylsulfonylphenyl)boronic acid (CAS 1402238-31-6) is a chemical compound with the molecular formula C7H8BFO4S and a molecular weight of 218.02 g/mol. IUPAC name: (4-fluoro-2-methylsulfonylphenyl)boronic acid. InChIKey: KAVXXYBTIPXTRQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO4S |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (4-fluoro-2-methylsulfonylphenyl)boronic acid |
| InChIKey | KAVXXYBTIPXTRQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)