CAS 648904-83-0 appears in our catalog under these names: 3-Fluoro-4-(methylsulfonyl)phenylboronic acid, 96%, 3–Fluoro–4–(methylsulfonyl)phenylboronic Acid, 3-Fluoro-4-(methylsulfonyl)phenylboronic Acid 98%, 3-Fluoro-4-(methylsulfonyl)phenylboronic acid, 97%, 97%, (3-Fluoro-4-(methylsulfonyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3-fluoro-4-methylsulfonylphenyl)boronic acid (CAS 648904-83-0) is a chemical compound with the molecular formula C7H8BFO4S and a molecular weight of 218.02 g/mol. IUPAC name: (3-fluoro-4-methylsulfonylphenyl)boronic acid. InChIKey: RJKFNKNDTBNEST-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO4S |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (3-fluoro-4-methylsulfonylphenyl)boronic acid |
| InChIKey | RJKFNKNDTBNEST-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)C)F)(O)O |
Computed by PubChem (NCBI)