cas: 1016516-68-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-Methoxybenzenesulfonyl Chloride, 98%, 98% (CAS 1016516-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11163T-100mg |
| cas | 1016516-68-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1466.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-methoxybenzenesulfonyl chloride (CAS 1016516-68-9) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 2-fluoro-4-methoxybenzenesulfonyl chloride. InChIKey: PFWTYPSGDVPOPQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-fluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | PFWTYPSGDVPOPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)