CAS 1049729-85-2 appears in our catalog under these names: 3-Fluoro-2-methoxybenzenesulfonyl chloride, 95%, 3-Fluoro-2-methoxy-benzenesulfonyl Chloride, 3-Fluoro-2-methoxybenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 250mg, 2,5g, 5g.
3-fluoro-2-methoxybenzenesulfonyl chloride (CAS 1049729-85-2) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 3-fluoro-2-methoxybenzenesulfonyl chloride. InChIKey: HNWSEIOPNICFIJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-fluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | HNWSEIOPNICFIJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)