CAS 1176126-31-0 appears in our catalog under these names: 2-Fluoro-6-methoxybenzenesulfonyl chloride, 95%, 2-Fluoro-6-methoxybenzenesulphonyl chloride, 98%, 2-Fluoro-6-methoxybenzenesulphonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 2,5g.
2-fluoro-6-methoxybenzenesulfonyl chloride (CAS 1176126-31-0) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 2-fluoro-6-methoxybenzenesulfonyl chloride. InChIKey: XJAVLIIXUXQDBO-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-fluoro-6-methoxybenzenesulfonyl chloride |
| InChIKey | XJAVLIIXUXQDBO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)