CAS 67475-55-2 appears in our catalog under these names: 3–Fluoro–4–methoxybenzene–1–sulfonyl chloride, 3-Fluoro-4-methoxybenzenesulfonyl chloride, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10g, 5g, 1g.
3-fluoro-4-methoxybenzenesulfonyl chloride (CAS 67475-55-2) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 3-fluoro-4-methoxybenzenesulfonyl chloride. InChIKey: QIVDOYCKCLEKPL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-fluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | QIVDOYCKCLEKPL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)