cas: 1016516-68-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-methoxybenzenesulfonyl chloride 98% (CAS 1016516-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340758-100mg |
| cas | 1016516-68-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1165.81 Pln | |
| Ambeed | 5g | 4392.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A340758 |
2-fluoro-4-methoxybenzenesulfonyl chloride (CAS 1016516-68-9) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 2-fluoro-4-methoxybenzenesulfonyl chloride. InChIKey: PFWTYPSGDVPOPQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-fluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | PFWTYPSGDVPOPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)