CAS 162101-31-7 appears in our catalog under these names: 2–Fluoro–4–methoxybenzeneboronic acid(contains varying amounts of Anhydride), 2-Fluoro-4-methoxyphenylboronic acid/ 95+%, 2-Fluoro-4-methoxybenzeneboronic acid, 98% , 2-Fluoro-4-methoxyphenylboronic acid, 97%, 2-Fluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
(2-fluoro-4-methoxyphenyl)boronic acid (CAS 162101-31-7) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: (2-fluoro-4-methoxyphenyl)boronic acid. InChIKey: ULUIXJDBPYBAHS-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | (2-fluoro-4-methoxyphenyl)boronic acid |
| InChIKey | ULUIXJDBPYBAHS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)F)(O)O |
Computed by PubChem (NCBI)