CAS 1061223-45-7 appears in our catalog under these names: Tavaborole Impurity 14, 4-Fluoro-2-(hydroxymethyl)phenylboronic Acid, (4–Fluoro–2–(hydroxymethyl)phenyl)boronic acid, (4-Fluoro-2-(hydroxymethyl)phenyl)boronic acid 95%, (4-Fluoro-2-(hydroxymethyl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 100mg, 1g, 250mg, 5g, 25g, 10g.
[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid (CAS 1061223-45-7) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [4-fluoro-2-(hydroxymethyl)phenyl]boronic acid. InChIKey: WDCNOFNVHZOFOW-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [4-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | WDCNOFNVHZOFOW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)CO)(O)O |
Computed by PubChem (NCBI)