cas: 1824271-04-6 — see every product listed under this CAS number, including other names
2-Fluoro-4-methyl-3-(trifluoromethyl)benzoyl chloride, 98% (CAS 1824271-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1237745-1g |
| cas | 1824271-04-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10902.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-fluoro-4-methyl-3-(trifluoromethyl)benzoyl chloride (CAS 1824271-04-6) is a chemical compound with the molecular formula C9H5ClF4O and a molecular weight of 240.58 g/mol. IUPAC name: 2-fluoro-4-methyl-3-(trifluoromethyl)benzoyl chloride. InChIKey: SRANUWKDSICOSZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF4O |
|---|---|
| Molecular weight | 240.58 g/mol |
| IUPAC name | 2-fluoro-4-methyl-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | SRANUWKDSICOSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)